Chemindex >5381-99-7
MY ▼
5381-99-7 2-Chloro-4H-1,3,2-benzodioxaphosphorin-4-one |
|
| Nama produk | 2-Chloro-4H-1,3,2-benzodioxaphosphorin-4-one |
| Nama Inggeris | 2-Chloro-4H-1,3,2-benzodioxaphosphorin-4-one;2-Chloro-1,3,2-benzodioxaphosphorin-4-one;ChloroHbenzodioxaphosphorinone;2-chloro-4H-1,3,2-benzodioxaphosphinin-4-one |
| MF | C7H4ClO3P |
| Berat Molekul | 202.5316 |
| InChI | InChI=1/C7H4ClO3P/c8-12-10-6-4-2-1-3-5(6)7(9)11-12/h1-4H |
| CAS NO | 5381-99-7 |
| Struktur Molekul |  |
| Titik lebur | 36-128℃ |
| Titik didih | 257.8°C at 760 mmHg |
| Titik nyala | 109.7°C |
| Tekanan wap | 0.0142mmHg at 25°C |
| Cinta bahaya |  C##Corrosive:; |
| Kod Risiko | R14##Reacts violently with water.||R34##Causes burns.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S8##Keep container dry.:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 