ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
579-49-7 (4-Fluorophenyl)-(2-thienyl) ketone |
|
Nama produk | (4-Fluorophenyl)-(2-thienyl) ketone |
Nama bahasa Inggris | (4-Fluorophenyl)-(2-thienyl) ketone;(4-Fluorophenyl)-2-thienyl methanone;4-Fluorophenyl-2-thienyl ketone;(4-fluorophenyl)(thiophen-2-yl)methanone |
MF | C11H7FOS |
Berat Molekul | 206.2361 |
InChI | InChI=1/C11H7FOS/c12-9-5-3-8(4-6-9)11(13)10-2-1-7-14-10/h1-7H |
CAS NO | 579-49-7 |
EINECS | 209-442-0 |
Struktur Molekul | ![]() |
Kepadatan | 1.279g/cm3 |
Titik lebur | 94-99℃ |
Titik didih | 314.7°C at 760 mmHg |
Indeks bias | 1.59 |
Titik nyala | 144.1°C |
Tekanan uap | 0.000459mmHg at 25°C |
Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
MSDS |