ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
579-49-7 (4-Fluorophenyl)-(2-thienyl) ketone |
|
Ürün Adı | (4-Fluorophenyl)-(2-thienyl) ketone |
ingilizce adı | (4-Fluorophenyl)-(2-thienyl) ketone;(4-Fluorophenyl)-2-thienyl methanone;4-Fluorophenyl-2-thienyl ketone;(4-fluorophenyl)(thiophen-2-yl)methanone |
Moleküler Formülü | C11H7FOS |
Molekül Ağırlığı | 206.2361 |
InChI | InChI=1/C11H7FOS/c12-9-5-3-8(4-6-9)11(13)10-2-1-7-14-10/h1-7H |
CAS kayıt numarası | 579-49-7 |
EINECS | 209-442-0 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.279g/cm3 |
Ergime noktası | 94-99℃ |
Kaynama noktası | 314.7°C at 760 mmHg |
Kırılma indisi | 1.59 |
Alevlenme noktası | 144.1°C |
Buhar basıncı | 0.000459mmHg at 25°C |
Güvenlik Açıklaması | S24/25##Avoid contact with skin and eyes.:; |
MSDS |