ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
579-49-7 (4-Fluorophenyl)-(2-thienyl) ketone |
|
نام محصول | (4-Fluorophenyl)-(2-thienyl) ketone |
نام انگلیسی | (4-Fluorophenyl)-(2-thienyl) ketone;(4-Fluorophenyl)-2-thienyl methanone;4-Fluorophenyl-2-thienyl ketone;(4-fluorophenyl)(thiophen-2-yl)methanone |
میدان مغناطیسی | C11H7FOS |
وزن مولکولی | 206.2361 |
InChI | InChI=1/C11H7FOS/c12-9-5-3-8(4-6-9)11(13)10-2-1-7-14-10/h1-7H |
شماره سیایاس | 579-49-7 |
تعداد کمیسیون اروپایی | 209-442-0 |
ساختار مولکولی | ![]() |
تراکم | 1.279g/cm3 |
نقطه ذوب | 94-99℃ |
نقطه غلیان | 314.7°C at 760 mmHg |
ضریب شکست | 1.59 |
نقطه اشتعال | 144.1°C |
فشار بخار | 0.000459mmHg at 25°C |
توضیحات ایمنی | S24/25##Avoid contact with skin and eyes.:; |
MSDS |