ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
579-49-7 (4-Fluorophenyl)-(2-thienyl) ketone |
|
उत्पाद का नाम | (4-Fluorophenyl)-(2-thienyl) ketone |
अंग्रेज | (4-Fluorophenyl)-(2-thienyl) ketone;(4-Fluorophenyl)-2-thienyl methanone;4-Fluorophenyl-2-thienyl ketone;(4-fluorophenyl)(thiophen-2-yl)methanone |
आणविक फार्मूला | C11H7FOS |
आण्विक वजन | 206.2361 |
InChI | InChI=1/C11H7FOS/c12-9-5-3-8(4-6-9)11(13)10-2-1-7-14-10/h1-7H |
कैस रजिस्टी संख्या | 579-49-7 |
EINECS | 209-442-0 |
आणविक संरचना | ![]() |
घनत्व | 1.279g/cm3 |
गलनांक | 94-99℃ |
उबलने का समय | 314.7°C at 760 mmHg |
अपवर्तक सूचकांक | 1.59 |
फ्लैश प्वाइंट | 144.1°C |
वाष्प का दबाव | 0.000459mmHg at 25°C |
सुरक्षा विवरण | S24/25##Avoid contact with skin and eyes.:; |
MSDS |