ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
321309-41-5 4-(1,3-oxazol-5-yl)פניל isothiocyanate |
|
| שם המוצר | 4-(1,3-oxazol-5-yl)פניל isothiocyanate |
| נרדפות | 5-(4-isothiocyanatophenyl)-1,3-oxazole; |
| שם אנגלי | 4-(1,3-oxazol-5-yl)phenyl isothiocyanate;5-(4-isothiocyanatophenyl)-1,3-oxazole |
| מולקולרית פורמולה | C10H6N2OS |
| משקל מולקולרי | 202.2324 |
| InChl | InChI=1/C10H6N2OS/c14-7-12-9-3-1-8(2-4-9)10-5-11-6-13-10/h1-6H |
| מספר CAS | 321309-41-5 |
| מבנה מולקולרי | ![]() |
| צפיפות | 1.25g/cm3 |
| נקודת ההתוך | 131℃ |
| נקודת רתיחה | 367°C at 760 mmHg |
| משקל סגולי | 1.644 |
| נקודת הבזק | 175.8°C |
| לחץ אדים | 2.97E-05mmHg at 25°C |
| Hazard סימנים | |
| סיכונים קודי | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |