ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
321309-41-5 izotiocyjanian 4-(1,3-oksazol-5-ylo)fenylu |
|
| Nazwa produktu: | izotiocyjanian 4-(1,3-oksazol-5-ylo)fenylu |
| Synonimy | 5-(4-izotiocyjanofenylo)-1,3-oksazol; |
| Angielska nazwa | 4-(1,3-oxazol-5-yl)phenyl isothiocyanate;5-(4-isothiocyanatophenyl)-1,3-oxazole |
| MF | C10H6N2OS |
| Masie cząsteczkowej | 202.2324 |
| InChI | InChI=1/C10H6N2OS/c14-7-12-9-3-1-8(2-4-9)10-5-11-6-13-10/h1-6H |
| Nr CAS | 321309-41-5 |
| Struktury molekularnej | ![]() |
| Gęstość | 1.25g/cm3 |
| Temperatura topnienia | 131℃ |
| Temperatura wrzenia | 367°C at 760 mmHg |
| Współczynnik załamania | 1.644 |
| Temperatura zapłonu | 175.8°C |
| Ciśnienie pary | 2.97E-05mmHg at 25°C |
| Symbole zagrożenia | |
| Kody ryzyka | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |