ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
321309-41-5 4- (1,3-oksazol-5-il) fenil izotiyosiyanat |
|
| Ürün Adı | 4- (1,3-oksazol-5-il) fenil izotiyosiyanat |
| Eş anlamlı | 5- (4-izotiyosiyatofenil) -1,3-oksazol; |
| ingilizce adı | 4-(1,3-oxazol-5-yl)phenyl isothiocyanate;5-(4-isothiocyanatophenyl)-1,3-oxazole |
| Moleküler Formülü | C10H6N2OS |
| Molekül Ağırlığı | 202.2324 |
| InChI | InChI=1/C10H6N2OS/c14-7-12-9-3-1-8(2-4-9)10-5-11-6-13-10/h1-6H |
| CAS kayıt numarası | 321309-41-5 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.25g/cm3 |
| Ergime noktası | 131℃ |
| Kaynama noktası | 367°C at 760 mmHg |
| Kırılma indisi | 1.644 |
| Alevlenme noktası | 175.8°C |
| Buhar basıncı | 2.97E-05mmHg at 25°C |
| Tehlike Sembolleri | |
| Risk Kodları | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |