Chemindex >321309-41-5
MY ▼
321309-41-5 4-(1,3-oxazol-5-yl)phenyl isothiocyanate |
|
| Nama produk | 4-(1,3-oxazol-5-yl)phenyl isothiocyanate |
| Sinonim | 5-(4-isothiocyanatophenyl)-1,3-oxazole; |
| Nama Inggeris | 4-(1,3-oxazol-5-yl)phenyl isothiocyanate;5-(4-isothiocyanatophenyl)-1,3-oxazole |
| MF | C10H6N2OS |
| Berat Molekul | 202.2324 |
| InChI | InChI=1/C10H6N2OS/c14-7-12-9-3-1-8(2-4-9)10-5-11-6-13-10/h1-6H |
| CAS NO | 321309-41-5 |
| Struktur Molekul |  |
| Kepadatan | 1.25g/cm3 |
| Titik lebur | 131℃ |
| Titik didih | 367°C at 760 mmHg |
| Indeks bias | 1.644 |
| Titik nyala | 175.8°C |
| Tekanan wap | 2.97E-05mmHg at 25°C |
| Cinta bahaya |  Xn##Harmful:; |
| Kod Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Pembekal untuk 321309-41-5 (0):
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 