ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
189807-20-3 2,3,6-trifluorobenzoyl chloride |
|
उत्पाद का नाम | 2,3,6-trifluorobenzoyl chloride |
अंग्रेज | 2,3,6-trifluorobenzoyl chloride;Trifluorobenzoylchloride |
आणविक फार्मूला | C7H2ClF3O |
आण्विक वजन | 194.5384 |
InChI | InChI=1/C7H2ClF3O/c8-7(12)5-3(9)1-2-4(10)6(5)11/h1-2H |
कैस रजिस्टी संख्या | 189807-20-3 |
आणविक संरचना | ![]() |
घनत्व | 1.514g/cm3 |
उबलने का समय | 180.1°C at 760 mmHg |
अपवर्तक सूचकांक | 1.479 |
फ्लैश प्वाइंट | 59°C |
वाष्प का दबाव | 0.913mmHg at 25°C |
खतरे के कोड | R34##Causes burns.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |