ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
189807-20-3 2,3,6-trifluorobenzoyl chloride |
|
상품명칭 | 2,3,6-trifluorobenzoyl chloride |
영문 이름 | 2,3,6-trifluorobenzoyl chloride;Trifluorobenzoylchloride |
분자식 | C7H2ClF3O |
분자량 | 194.5384 |
InChI | InChI=1/C7H2ClF3O/c8-7(12)5-3(9)1-2-4(10)6(5)11/h1-2H |
cas번호 | 189807-20-3 |
분자 구조 | ![]() |
밀도 | 1.514g/cm3 |
비등점 | 180.1°C at 760 mmHg |
굴절 지수 | 1.479 |
인화점 | 59°C |
증기압 | 0.913mmHg at 25°C |
리스크 규칙 | R34##Causes burns.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |