ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
189807-20-3 2,3,6-trifluorobenzoyl chloride |
|
Ürün Adı | 2,3,6-trifluorobenzoyl chloride |
ingilizce adı | 2,3,6-trifluorobenzoyl chloride;Trifluorobenzoylchloride |
Moleküler Formülü | C7H2ClF3O |
Molekül Ağırlığı | 194.5384 |
InChI | InChI=1/C7H2ClF3O/c8-7(12)5-3(9)1-2-4(10)6(5)11/h1-2H |
CAS kayıt numarası | 189807-20-3 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.514g/cm3 |
Kaynama noktası | 180.1°C at 760 mmHg |
Kırılma indisi | 1.479 |
Alevlenme noktası | 59°C |
Buhar basıncı | 0.913mmHg at 25°C |
Risk Kodları | R34##Causes burns.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |