ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
189807-20-3 2,3,6-trifluorobenzoyl chloride |
|
اسم المنتج | 2,3,6-trifluorobenzoyl chloride |
الاسم بالانجليزية | 2,3,6-trifluorobenzoyl chloride;Trifluorobenzoylchloride |
الصيغة الجزيئية | C7H2ClF3O |
الوزن الجزيئي الغرامي | 194.5384 |
InChI | InChI=1/C7H2ClF3O/c8-7(12)5-3(9)1-2-4(10)6(5)11/h1-2H |
إستراتيجية المساعدة القطرية | 189807-20-3 |
بنية جزيئية | ![]() |
كثافة | 1.514g/cm3 |
نقطة الغليان | 180.1°C at 760 mmHg |
معامل الإنكسار | 1.479 |
نقطة الوميض | 59°C |
ضغط البخار | 0.913mmHg at 25°C |
خطر المصطلحات | R34##Causes burns.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |