ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
207981-50-8 2,6-difluoromandelic acid |
|
उत्पाद का नाम | 2,6-difluoromandelic acid |
अंग्रेज | 2,6-difluoromandelic acid;alpha-Hydroxy-2,6-difluorophenylacetic acid;(2,6-difluorophenyl)(hydroxy)acetic acid |
आणविक फार्मूला | C8H6F2O3 |
आण्विक वजन | 188.1282 |
InChI | InChI=1/C8H6F2O3/c9-4-2-1-3-5(10)6(4)7(11)8(12)13/h1-3,7,11H,(H,12,13) |
कैस रजिस्टी संख्या | 207981-50-8 |
आणविक संरचना | ![]() |
घनत्व | 1.522g/cm3 |
उबलने का समय | 299.3°C at 760 mmHg |
अपवर्तक सूचकांक | 1.542 |
फ्लैश प्वाइंट | 134.8°C |
वाष्प का दबाव | 0.000539mmHg at 25°C |
खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |