ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
207981-50-8 2,6-difluoromandelic acid |
|
produktnavn | 2,6-difluoromandelic acid |
Engelsk navn | 2,6-difluoromandelic acid;alpha-Hydroxy-2,6-difluorophenylacetic acid;(2,6-difluorophenyl)(hydroxy)acetic acid |
Molekylær Formel | C8H6F2O3 |
Molekylvekt | 188.1282 |
InChI | InChI=1/C8H6F2O3/c9-4-2-1-3-5(10)6(4)7(11)8(12)13/h1-3,7,11H,(H,12,13) |
CAS-nummer | 207981-50-8 |
Molecular Structure | ![]() |
Tetthet | 1.522g/cm3 |
Kokepunkt | 299.3°C at 760 mmHg |
Brytningsindeks | 1.542 |
Flammepunktet | 134.8°C |
Damptrykk | 0.000539mmHg at 25°C |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |