Chemindex > 207981-50-8
KR ▼
207981-50-8 2,6-difluoromandelic acid |
|
| 상품명칭 | 2,6-difluoromandelic acid |
| 영문 이름 | 2,6-difluoromandelic acid;alpha-Hydroxy-2,6-difluorophenylacetic acid;(2,6-difluorophenyl)(hydroxy)acetic acid |
| 분자식 | C8H6F2O3 |
| 분자량 | 188.1282 |
| InChI | InChI=1/C8H6F2O3/c9-4-2-1-3-5(10)6(4)7(11)8(12)13/h1-3,7,11H,(H,12,13) |
| cas번호 | 207981-50-8 |
| 분자 구조 |  |
| 밀도 | 1.522g/cm3 |
| 비등점 | 299.3°C at 760 mmHg |
| 굴절 지수 | 1.542 |
| 인화점 | 134.8°C |
| 증기압 | 0.000539mmHg at 25°C |
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 