ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
368869-89-0 5- (2-मिथाइल-1,3-थियाज़ोल-4-वाईएल) -3-आइसोक्साज़ोलकार्बोनिल क्लोराइड |
|
| उत्पाद का नाम | 5- (2-मिथाइल-1,3-थियाज़ोल-4-वाईएल) -3-आइसोक्साज़ोलकार्बोनिल क्लोराइड |
| समानार्थी | 5- (2-मिथाइल-1,3-थियाज़ोल-4-वाईएल) आइसोक्साज़ोल-3-कार्बोनिल क्लोराइड; |
| अंग्रेज | 5-(2-methyl-1,3-thiazol-4-yl)-3-isoxazolecarbonyl chloride;5-(2-methyl-1,3-thiazol-4-yl)isoxazole-3-carbonyl chloride |
| आणविक फार्मूला | C8H5ClN2O2S |
| आण्विक वजन | 228.6555 |
| InChI | InChI=1/C8H5ClN2O2S/c1-4-10-6(3-14-4)7-2-5(8(9)12)11-13-7/h2-3H,1H3 |
| कैस रजिस्टी संख्या | 368869-89-0 |
| आणविक संरचना | ![]() |
| घनत्व | 1.464g/cm3 |
| गलनांक | 170℃ |
| उबलने का समय | 412.1°C at 760 mmHg |
| अपवर्तक सूचकांक | 1.591 |
| फ्लैश प्वाइंट | 203°C |
| वाष्प का दबाव | 5.33E-07mmHg at 25°C |
| खतरा प्रतीक | |
| खतरे के कोड | R34##Causes burns.:; |
| सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |