ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
368869-89-0 5-(2-methyl-1,3-thiazol-4-yl)-3-isoxazolecarbonyl klorida |
|
Nama produk | 5-(2-methyl-1,3-thiazol-4-yl)-3-isoxazolecarbonyl klorida |
Sinonim | 5-(2-methyl-1,3-thiazol-4-yl)isoxazole-3-carbonyl chloride; |
Nama Inggeris | 5-(2-methyl-1,3-thiazol-4-yl)-3-isoxazolecarbonyl chloride;5-(2-methyl-1,3-thiazol-4-yl)isoxazole-3-carbonyl chloride |
MF | C8H5ClN2O2S |
Berat Molekul | 228.6555 |
InChI | InChI=1/C8H5ClN2O2S/c1-4-10-6(3-14-4)7-2-5(8(9)12)11-13-7/h2-3H,1H3 |
CAS NO | 368869-89-0 |
Struktur Molekul | ![]() |
Kepadatan | 1.464g/cm3 |
Titik lebur | 170℃ |
Titik didih | 412.1°C at 760 mmHg |
Indeks bias | 1.591 |
Titik nyala | 203°C |
Tekanan wap | 5.33E-07mmHg at 25°C |
Cinta bahaya | |
Kod Risiko | R34##Causes burns.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |