Chemindex >368869-89-0
MY ▼
368869-89-0 5-(2-methyl-1,3-thiazol-4-yl)-3-isoxazolecarbonyl klorida |
|
| Nama produk | 5-(2-methyl-1,3-thiazol-4-yl)-3-isoxazolecarbonyl klorida |
| Sinonim | 5-(2-methyl-1,3-thiazol-4-yl)isoxazole-3-carbonyl chloride; |
| Nama Inggeris | 5-(2-methyl-1,3-thiazol-4-yl)-3-isoxazolecarbonyl chloride;5-(2-methyl-1,3-thiazol-4-yl)isoxazole-3-carbonyl chloride |
| MF | C8H5ClN2O2S |
| Berat Molekul | 228.6555 |
| InChI | InChI=1/C8H5ClN2O2S/c1-4-10-6(3-14-4)7-2-5(8(9)12)11-13-7/h2-3H,1H3 |
| CAS NO | 368869-89-0 |
| Struktur Molekul |  |
| Kepadatan | 1.464g/cm3 |
| Titik lebur | 170℃ |
| Titik didih | 412.1°C at 760 mmHg |
| Indeks bias | 1.591 |
| Titik nyala | 203°C |
| Tekanan wap | 5.33E-07mmHg at 25°C |
| Cinta bahaya |  C##Corrosive:; |
| Kod Risiko | R34##Causes burns.:; |
| Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Pembekal untuk 368869-89-0 (0):
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 