ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
368869-89-0 5-(2-methyl-1,3-thiazol-4-yl)-3-isoxazolcarbonylchloride |
|
| Naam product | 5-(2-methyl-1,3-thiazol-4-yl)-3-isoxazolcarbonylchloride |
| Synoniemen | 5-(2-methyl-1,3-thiazool-4-yl)isoxazol-3-carbonylchloride; |
| Engelse naam | 5-(2-methyl-1,3-thiazol-4-yl)-3-isoxazolecarbonyl chloride;5-(2-methyl-1,3-thiazol-4-yl)isoxazole-3-carbonyl chloride |
| MF | C8H5ClN2O2S |
| Molecuulgewicht | 228.6555 |
| InChI | InChI=1/C8H5ClN2O2S/c1-4-10-6(3-14-4)7-2-5(8(9)12)11-13-7/h2-3H,1H3 |
| CAS-nummer | 368869-89-0 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.464g/cm3 |
| Smeltpunt | 170℃ |
| Kookpunt | 412.1°C at 760 mmHg |
| Brekingsindex | 1.591 |
| Vlampunt | 203°C |
| Dampdruk | 5.33E-07mmHg at 25°C |
| Gevaarsymbolen | |
| Risico-codes | R34##Causes burns.:; |
| Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |