Chemindex > 368869-89-0
KR ▼
368869-89-0 5- (2- 메틸 -1,3- 티아 졸 -4- 일) -3- 이소 옥사 졸 카르 보닐 클로라이드 |
|
| 상품명칭 | 5- (2- 메틸 -1,3- 티아 졸 -4- 일) -3- 이소 옥사 졸 카르 보닐 클로라이드 |
| 별명 | 5-(2-메틸-1,3-티아졸-4-일)이소옥사졸-3-카르보닐 클로라이드; |
| 영문 이름 | 5-(2-methyl-1,3-thiazol-4-yl)-3-isoxazolecarbonyl chloride;5-(2-methyl-1,3-thiazol-4-yl)isoxazole-3-carbonyl chloride |
| 분자식 | C8H5ClN2O2S |
| 분자량 | 228.6555 |
| InChI | InChI=1/C8H5ClN2O2S/c1-4-10-6(3-14-4)7-2-5(8(9)12)11-13-7/h2-3H,1H3 |
| cas번호 | 368869-89-0 |
| 분자 구조 |  |
| 밀도 | 1.464g/cm3 |
| 녹는 점 | 170℃ |
| 비등점 | 412.1°C at 760 mmHg |
| 굴절 지수 | 1.591 |
| 인화점 | 203°C |
| 증기압 | 5.33E-07mmHg at 25°C |
| 위험성 표시 |  C##Corrosive:; |
| 리스크 규칙 | R34##Causes burns.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
368869-89-0 (0) 공급 업체:
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 