ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
636-93-1 2-methoxy-5-nitrophenol |
|
उत्पाद का नाम | 2-methoxy-5-nitrophenol |
अंग्रेज | 2-methoxy-5-nitrophenol;5-Nitroguaiacol (3-Hydroxy-4-methoxynitrobenzene);3-Hydroxy-4-methoxynitrobenzene~5-Nitroguaiacol;5-Nitroguaiacol |
आणविक फार्मूला | C7H7NO4 |
आण्विक वजन | 169.1348 |
InChI | InChI=1/C7H7NO4/c1-12-7-3-2-5(8(10)11)4-6(7)9/h2-4,9H,1H3 |
कैस रजिस्टी संख्या | 636-93-1 |
EINECS | 211-269-0 |
आणविक संरचना | ![]() |
घनत्व | 1.367g/cm3 |
गलनांक | 103-107℃ |
उबलने का समय | 291°C at 760 mmHg |
अपवर्तक सूचकांक | 1.583 |
फ्लैश प्वाइंट | 147.1°C |
वाष्प का दबाव | 0.00115mmHg at 25°C |
खतरे के कोड | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |