ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
636-93-1 2-methoxy-5-nitrophenol |
|
نام محصول | 2-methoxy-5-nitrophenol |
نام انگلیسی | 2-methoxy-5-nitrophenol;5-Nitroguaiacol (3-Hydroxy-4-methoxynitrobenzene);3-Hydroxy-4-methoxynitrobenzene~5-Nitroguaiacol;5-Nitroguaiacol |
میدان مغناطیسی | C7H7NO4 |
وزن مولکولی | 169.1348 |
InChI | InChI=1/C7H7NO4/c1-12-7-3-2-5(8(10)11)4-6(7)9/h2-4,9H,1H3 |
شماره سیایاس | 636-93-1 |
تعداد کمیسیون اروپایی | 211-269-0 |
ساختار مولکولی | ![]() |
تراکم | 1.367g/cm3 |
نقطه ذوب | 103-107℃ |
نقطه غلیان | 291°C at 760 mmHg |
ضریب شکست | 1.583 |
نقطه اشتعال | 147.1°C |
فشار بخار | 0.00115mmHg at 25°C |
کدهای خطر | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |