ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
636-93-1 2-methoxy-5-nitrophenol |
|
Nama produk | 2-methoxy-5-nitrophenol |
Nama Inggeris | 2-methoxy-5-nitrophenol;5-Nitroguaiacol (3-Hydroxy-4-methoxynitrobenzene);3-Hydroxy-4-methoxynitrobenzene~5-Nitroguaiacol;5-Nitroguaiacol |
MF | C7H7NO4 |
Berat Molekul | 169.1348 |
InChI | InChI=1/C7H7NO4/c1-12-7-3-2-5(8(10)11)4-6(7)9/h2-4,9H,1H3 |
CAS NO | 636-93-1 |
EINECS | 211-269-0 |
Struktur Molekul | ![]() |
Kepadatan | 1.367g/cm3 |
Titik lebur | 103-107℃ |
Titik didih | 291°C at 760 mmHg |
Indeks bias | 1.583 |
Titik nyala | 147.1°C |
Tekanan wap | 0.00115mmHg at 25°C |
Kod Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |