ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
636-93-1 2-methoxy-5-nitrophenol |
|
상품명칭 | 2-methoxy-5-nitrophenol |
영문 이름 | 2-methoxy-5-nitrophenol;5-Nitroguaiacol (3-Hydroxy-4-methoxynitrobenzene);3-Hydroxy-4-methoxynitrobenzene~5-Nitroguaiacol;5-Nitroguaiacol |
분자식 | C7H7NO4 |
분자량 | 169.1348 |
InChI | InChI=1/C7H7NO4/c1-12-7-3-2-5(8(10)11)4-6(7)9/h2-4,9H,1H3 |
cas번호 | 636-93-1 |
EC번호 | 211-269-0 |
분자 구조 | ![]() |
밀도 | 1.367g/cm3 |
녹는 점 | 103-107℃ |
비등점 | 291°C at 760 mmHg |
굴절 지수 | 1.583 |
인화점 | 147.1°C |
증기압 | 0.00115mmHg at 25°C |
리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |