ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
157373-08-5 2,3,4-trifluorobenzoyl chloride |
|
نام محصول | 2,3,4-trifluorobenzoyl chloride |
نام انگلیسی | 2,3,4-trifluorobenzoyl chloride; |
میدان مغناطیسی | C7H2ClF3O |
وزن مولکولی | 194.5384 |
InChI | InChI=1/C7H2ClF3O/c8-7(12)3-1-2-4(9)6(11)5(3)10/h1-2H |
شماره سیایاس | 157373-08-5 |
ساختار مولکولی | ![]() |
تراکم | 1.514g/cm3 |
نقطه غلیان | 203.2°C at 760 mmHg |
ضریب شکست | 1.479 |
نقطه اشتعال | 60.4°C |
فشار بخار | 0.28mmHg at 25°C |
خطر نمادها | |
کدهای خطر | R34##Causes burns.||R36/37##Irritating to eyes and respiratory system.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |