ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
157373-08-5 2,3,4-trifluorobenzoyl chloride |
|
produktnavn | 2,3,4-trifluorobenzoyl chloride |
Engelsk navn | 2,3,4-trifluorobenzoyl chloride; |
Molekylær Formel | C7H2ClF3O |
Molekylvekt | 194.5384 |
InChI | InChI=1/C7H2ClF3O/c8-7(12)3-1-2-4(9)6(11)5(3)10/h1-2H |
CAS-nummer | 157373-08-5 |
Molecular Structure | ![]() |
Tetthet | 1.514g/cm3 |
Kokepunkt | 203.2°C at 760 mmHg |
Brytningsindeks | 1.479 |
Flammepunktet | 60.4°C |
Damptrykk | 0.28mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R34##Causes burns.||R36/37##Irritating to eyes and respiratory system.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |