ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
157373-08-5 2,3,4-trifluorobenzoyl chloride |
|
Ürün Adı | 2,3,4-trifluorobenzoyl chloride |
ingilizce adı | 2,3,4-trifluorobenzoyl chloride; |
Moleküler Formülü | C7H2ClF3O |
Molekül Ağırlığı | 194.5384 |
InChI | InChI=1/C7H2ClF3O/c8-7(12)3-1-2-4(9)6(11)5(3)10/h1-2H |
CAS kayıt numarası | 157373-08-5 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.514g/cm3 |
Kaynama noktası | 203.2°C at 760 mmHg |
Kırılma indisi | 1.479 |
Alevlenme noktası | 60.4°C |
Buhar basıncı | 0.28mmHg at 25°C |
Tehlike Sembolleri | |
Risk Kodları | R34##Causes burns.||R36/37##Irritating to eyes and respiratory system.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |