ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
157373-08-5 2,3,4-trifluorobenzoyl chloride |
|
Nazwa produktu: | 2,3,4-trifluorobenzoyl chloride |
Angielska nazwa | 2,3,4-trifluorobenzoyl chloride; |
MF | C7H2ClF3O |
Masie cząsteczkowej | 194.5384 |
InChI | InChI=1/C7H2ClF3O/c8-7(12)3-1-2-4(9)6(11)5(3)10/h1-2H |
Nr CAS | 157373-08-5 |
Struktury molekularnej | ![]() |
Gęstość | 1.514g/cm3 |
Temperatura wrzenia | 203.2°C at 760 mmHg |
Współczynnik załamania | 1.479 |
Temperatura zapłonu | 60.4°C |
Ciśnienie pary | 0.28mmHg at 25°C |
Symbole zagrożenia | |
Kody ryzyka | R34##Causes burns.||R36/37##Irritating to eyes and respiratory system.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |