ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
437-64-9 4',5-Dihydroxy-7-methoxyflavone | 
    |
| نام محصول | 4',5-Dihydroxy-7-methoxyflavone | 
| نام انگلیسی | 4',5-Dihydroxy-7-methoxyflavone;Genkwanin;Gengkwanin | 
| میدان مغناطیسی | C16H12O5 | 
| وزن مولکولی | 284.26 | 
| InChI | InChI=1/C16H12O5/c1-20-11-6-12(18)16-13(19)8-14(21-15(16)7-11)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 | 
| شماره سیایاس | 437-64-9 | 
| ساختار مولکولی | ![]()  | 
    
| کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; | 
    
| توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; | 
    
| MSDS | |