ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
437-64-9 4',5-Dihydroxy-7-methoxyflavone |
|
| Nome del prodotto | 4',5-Dihydroxy-7-methoxyflavone |
| Nome inglese | 4',5-Dihydroxy-7-methoxyflavone;Genkwanin;Gengkwanin |
| Formula molecolare | C16H12O5 |
| Peso Molecolare | 284.26 |
| InChI | InChI=1/C16H12O5/c1-20-11-6-12(18)16-13(19)8-14(21-15(16)7-11)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
| Numero CAS | 437-64-9 |
| Struttura molecolare | ![]() |
| Codici di Rischio | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |