ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
437-64-9 4',5-Dihydroxy-7-methoxyflavone | 
    |
| Nome do produto | 4',5-Dihydroxy-7-methoxyflavone | 
| Nome em inglês | 4',5-Dihydroxy-7-methoxyflavone;Genkwanin;Gengkwanin | 
| Fórmula molecular | C16H12O5 | 
| Peso Molecular | 284.26 | 
| InChI | InChI=1/C16H12O5/c1-20-11-6-12(18)16-13(19)8-14(21-15(16)7-11)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 | 
| CAS Registry Number | 437-64-9 | 
| Estrutura Molecular | ![]()  | 
    
| Códigos de risco | R36/37/38##Irritating to eyes, respiratory system and skin.:; | 
    
| Descrição da Segurança | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; | 
    
| MSDS | |