ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
437-64-9 4',5-Dihydroxy-7-methoxyflavone | 
    |
| produktnavn | 4',5-Dihydroxy-7-methoxyflavone | 
| Engelsk navn | 4',5-Dihydroxy-7-methoxyflavone;Genkwanin;Gengkwanin | 
| Molekylær Formel | C16H12O5 | 
| Molekylvekt | 284.26 | 
| InChI | InChI=1/C16H12O5/c1-20-11-6-12(18)16-13(19)8-14(21-15(16)7-11)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 | 
| CAS-nummer | 437-64-9 | 
| Molecular Structure | ![]()  | 
    
| Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; | 
    
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; | 
    
| MSDS | |