ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
513-81-5 2,3-Dimethylbutadiene-1,3 |
|
| نام محصول | 2,3-Dimethylbutadiene-1,3 |
| نام انگلیسی | 2,3-Dimethylbutadiene-1,3;2,3-Dimethyl-1,3-butadiene;2,3-dimethylbuta-1,3-diene |
| میدان مغناطیسی | C6H10 |
| وزن مولکولی | 82.1436 |
| InChI | InChI=1/C6H10/c1-5(2)6(3)4/h1,3H2,2,4H3 |
| شماره سیایاس | 513-81-5 |
| تعداد کمیسیون اروپایی | 208-172-0 |
| ساختار مولکولی | ![]() |
| تراکم | 0.699g/cm3 |
| نقطه غلیان | 68.8°C at 760 mmHg |
| ضریب شکست | 1.408 |
| فشار بخار | 150mmHg at 25°C |
| کدهای خطر | R11##Highly flammable.||R65##Harmful: may cause lung damage if swallowed.:; |
| توضیحات ایمنی | S16##Keep away from sources of ignition - No smoking.||S23##Do not inhale gas/fumes/vapour/spray.||S33##Take precautionary measures against static discharges.||S62##If swallowed, do not induce vomiting: seek medical advice immediately and show this container or label.:; |
| MSDS | |