ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
513-81-5 2,3-Dimethylbutadiene-1,3 |
|
| produktnavn | 2,3-Dimethylbutadiene-1,3 |
| Engelsk navn | 2,3-Dimethylbutadiene-1,3;2,3-Dimethyl-1,3-butadiene;2,3-dimethylbuta-1,3-diene |
| Molekylær Formel | C6H10 |
| Molekylvekt | 82.1436 |
| InChI | InChI=1/C6H10/c1-5(2)6(3)4/h1,3H2,2,4H3 |
| CAS-nummer | 513-81-5 |
| EINECS | 208-172-0 |
| Molecular Structure | ![]() |
| Tetthet | 0.699g/cm3 |
| Kokepunkt | 68.8°C at 760 mmHg |
| Brytningsindeks | 1.408 |
| Damptrykk | 150mmHg at 25°C |
| Risiko Koder | R11##Highly flammable.||R65##Harmful: may cause lung damage if swallowed.:; |
| Sikkerhet Beskrivelse | S16##Keep away from sources of ignition - No smoking.||S23##Do not inhale gas/fumes/vapour/spray.||S33##Take precautionary measures against static discharges.||S62##If swallowed, do not induce vomiting: seek medical advice immediately and show this container or label.:; |
| MSDS | |