ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
513-81-5 2,3-Dimethylbutadiene-1,3 |
|
| Nazwa produktu: | 2,3-Dimethylbutadiene-1,3 |
| Angielska nazwa | 2,3-Dimethylbutadiene-1,3;2,3-Dimethyl-1,3-butadiene;2,3-dimethylbuta-1,3-diene |
| MF | C6H10 |
| Masie cząsteczkowej | 82.1436 |
| InChI | InChI=1/C6H10/c1-5(2)6(3)4/h1,3H2,2,4H3 |
| Nr CAS | 513-81-5 |
| EINECS | 208-172-0 |
| Struktury molekularnej | ![]() |
| Gęstość | 0.699g/cm3 |
| Temperatura wrzenia | 68.8°C at 760 mmHg |
| Współczynnik załamania | 1.408 |
| Ciśnienie pary | 150mmHg at 25°C |
| Kody ryzyka | R11##Highly flammable.||R65##Harmful: may cause lung damage if swallowed.:; |
| Bezpieczeństwo opis | S16##Keep away from sources of ignition - No smoking.||S23##Do not inhale gas/fumes/vapour/spray.||S33##Take precautionary measures against static discharges.||S62##If swallowed, do not induce vomiting: seek medical advice immediately and show this container or label.:; |
| MSDS | |