ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
513-81-5 2,3-Dimethylbutadiene-1,3 |
|
| اسم المنتج | 2,3-Dimethylbutadiene-1,3 |
| الاسم بالانجليزية | 2,3-Dimethylbutadiene-1,3;2,3-Dimethyl-1,3-butadiene;2,3-dimethylbuta-1,3-diene |
| الصيغة الجزيئية | C6H10 |
| الوزن الجزيئي الغرامي | 82.1436 |
| InChI | InChI=1/C6H10/c1-5(2)6(3)4/h1,3H2,2,4H3 |
| إستراتيجية المساعدة القطرية | 513-81-5 |
| المفوضية الأوروبية رقم | 208-172-0 |
| بنية جزيئية | ![]() |
| كثافة | 0.699g/cm3 |
| نقطة الغليان | 68.8°C at 760 mmHg |
| معامل الإنكسار | 1.408 |
| ضغط البخار | 150mmHg at 25°C |
| خطر المصطلحات | R11##Highly flammable.||R65##Harmful: may cause lung damage if swallowed.:; |
| شروط الأمن | S16##Keep away from sources of ignition - No smoking.||S23##Do not inhale gas/fumes/vapour/spray.||S33##Take precautionary measures against static discharges.||S62##If swallowed, do not induce vomiting: seek medical advice immediately and show this container or label.:; |
| MSDS | |