ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
106-42-3 p-Xylene |
|
| Nome del prodotto | p-Xylene |
| Nome inglese | p-Xylene;1,4-Dimethylbenzene;para-xylene;Dibencoside;1,4-xylene |
| Formula molecolare | C8H10 |
| Peso Molecolare | 106.1674 |
| InChI | InChI:1S/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3 |
| Numero CAS | 106-42-3 |
| EINECS | 203-396-5 |
| Struttura molecolare | ![]() |
| Punto di fusione | 13-13℃ |
| Punto di ebollizione | 139.61°C at 760 mmHg |
| Punto d'infiammabilità | 24.627°C |
| Pressione di vapore | 7.943mmHg at 25°C |
| Simboli di pericolo | |
| Codici di Rischio | R10##Flammable.||R20/21##Harmful by inhalation and in contact with skin.||R38##Irritating to skin.:; |
| Sicurezza Descrizione | S25##Avoid contact with eyes.:; |
| MSDS | |