ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
106-42-3 p-Xylene |
|
| produktnavn | p-Xylene |
| Engelsk navn | p-Xylene;1,4-Dimethylbenzene;para-xylene;Dibencoside;1,4-xylene |
| Molekylær Formel | C8H10 |
| Molekylvekt | 106.1674 |
| InChI | InChI:1S/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3 |
| CAS-nummer | 106-42-3 |
| EINECS | 203-396-5 |
| Molecular Structure | ![]() |
| Smeltepunkt | 13-13℃ |
| Kokepunkt | 139.61°C at 760 mmHg |
| Flammepunktet | 24.627°C |
| Damptrykk | 7.943mmHg at 25°C |
| Hazard symboler | |
| Risiko Koder | R10##Flammable.||R20/21##Harmful by inhalation and in contact with skin.||R38##Irritating to skin.:; |
| Sikkerhet Beskrivelse | S25##Avoid contact with eyes.:; |
| MSDS | |