ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
106-42-3 p-Xylene |
|
| 상품명칭 | p-Xylene |
| 영문 이름 | p-Xylene;1,4-Dimethylbenzene;para-xylene;Dibencoside;1,4-xylene |
| 분자식 | C8H10 |
| 분자량 | 106.1674 |
| InChI | InChI:1S/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3 |
| cas번호 | 106-42-3 |
| EC번호 | 203-396-5 |
| 분자 구조 | ![]() |
| 녹는 점 | 13-13℃ |
| 비등점 | 139.61°C at 760 mmHg |
| 인화점 | 24.627°C |
| 증기압 | 7.943mmHg at 25°C |
| 위험성 표시 | |
| 리스크 규칙 | R10##Flammable.||R20/21##Harmful by inhalation and in contact with skin.||R38##Irritating to skin.:; |
| 보안 규칙 | S25##Avoid contact with eyes.:; |
| MSDS | |