ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
106-42-3 p-Xylene |
|
| Nazwa produktu: | p-Xylene |
| Angielska nazwa | p-Xylene;1,4-Dimethylbenzene;para-xylene;Dibencoside;1,4-xylene |
| MF | C8H10 |
| Masie cząsteczkowej | 106.1674 |
| InChI | InChI:1S/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3 |
| Nr CAS | 106-42-3 |
| EINECS | 203-396-5 |
| Struktury molekularnej | ![]() |
| Temperatura topnienia | 13-13℃ |
| Temperatura wrzenia | 139.61°C at 760 mmHg |
| Temperatura zapłonu | 24.627°C |
| Ciśnienie pary | 7.943mmHg at 25°C |
| Symbole zagrożenia | |
| Kody ryzyka | R10##Flammable.||R20/21##Harmful by inhalation and in contact with skin.||R38##Irritating to skin.:; |
| Bezpieczeństwo opis | S25##Avoid contact with eyes.:; |
| MSDS | |