ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
814-68-6 Acryloyl chloride |
|
| 상품명칭 | Acryloyl chloride |
| 영문 이름 | Acryloyl chloride;Propenoyl chloride;Acrylyl chloride;prop-2-enoyl chloride;Acyloyl chloride |
| 분자식 | C3H3OCl |
| 분자량 | 90.5083 |
| InChI | InChI=1/C3H3ClO/c1-2-3(4)5/h2H,1H2 |
| cas번호 | 814-68-6 |
| EC번호 | 212-399-0 |
| 분자 구조 | ![]() |
| 밀도 | 1.108g/cm3 |
| 비등점 | 75.5°C at 760 mmHg |
| 굴절 지수 | 1.417 |
| 인화점 | 16.1°C |
| 증기압 | 105mmHg at 25°C |
| 위험성 표시 | |
| 리스크 규칙 | R11##Highly flammable.||R34##Causes burns.:; |
| 보안 규칙 | S16##Keep away from sources of ignition - No smoking.||S30##Never add water to this product.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |