ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
345-70-0 3,3'-difluorobenzophenone |
|
| Naam product | 3,3'-difluorobenzophenone |
| Engelse naam | 3,3'-difluorobenzophenone;bis(3-fluorophenyl)methanone |
| MF | C13H8F2O |
| Molecuulgewicht | 218.1988 |
| InChI | InChI=1/C13H8F2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H |
| CAS-nummer | 345-70-0 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.239g/cm3 |
| Smeltpunt | 56-59℃ |
| Kookpunt | 316.2°C at 760 mmHg |
| Brekingsindex | 1.549 |
| Vlampunt | 121.3°C |
| Dampdruk | 0.000415mmHg at 25°C |
| Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |