ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
345-70-0 3,3'-difluorobenzophenone | 
    |
| اسم المنتج | 3,3'-difluorobenzophenone | 
| الاسم بالانجليزية | 3,3'-difluorobenzophenone;bis(3-fluorophenyl)methanone | 
| الصيغة الجزيئية | C13H8F2O | 
| الوزن الجزيئي الغرامي | 218.1988 | 
| InChI | InChI=1/C13H8F2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H | 
| إستراتيجية المساعدة القطرية | 345-70-0 | 
| بنية جزيئية | ![]()  | 
    
| كثافة | 1.239g/cm3 | 
| درجة الإنصهار | 56-59℃ | 
| نقطة الغليان | 316.2°C at 760 mmHg | 
| معامل الإنكسار | 1.549 | 
| نقطة الوميض | 121.3°C | 
| ضغط البخار | 0.000415mmHg at 25°C | 
| خطر المصطلحات | R36/37/38##Irritating to eyes, respiratory system and skin.:; | 
    
| شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; | 
    
| MSDS | |