ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
345-70-0 3,3'-difluorobenzophenone | 
    |
| Nome do produto | 3,3'-difluorobenzophenone | 
| Nome em inglês | 3,3'-difluorobenzophenone;bis(3-fluorophenyl)methanone | 
| Fórmula molecular | C13H8F2O | 
| Peso Molecular | 218.1988 | 
| InChI | InChI=1/C13H8F2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H | 
| CAS Registry Number | 345-70-0 | 
| Estrutura Molecular | ![]()  | 
    
| Densidade | 1.239g/cm3 | 
| Ponto de fusão | 56-59℃ | 
| Ponto de ebulição | 316.2°C at 760 mmHg | 
| índice de refração | 1.549 | 
| O ponto de inflamação | 121.3°C | 
| Pressão de vapor | 0.000415mmHg at 25°C | 
| Códigos de risco | R36/37/38##Irritating to eyes, respiratory system and skin.:; | 
    
| Descrição da Segurança | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; | 
    
| MSDS | |