ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
345-70-0 3,3'-difluorobenzophenone | 
    |
| Ürün Adı | 3,3'-difluorobenzophenone | 
| ingilizce adı | 3,3'-difluorobenzophenone;bis(3-fluorophenyl)methanone | 
| Moleküler Formülü | C13H8F2O | 
| Molekül Ağırlığı | 218.1988 | 
| InChI | InChI=1/C13H8F2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H | 
| CAS kayıt numarası | 345-70-0 | 
| Moleküler Yapısı | ![]()  | 
    
| Yoğunluk | 1.239g/cm3 | 
| Ergime noktası | 56-59℃ | 
| Kaynama noktası | 316.2°C at 760 mmHg | 
| Kırılma indisi | 1.549 | 
| Alevlenme noktası | 121.3°C | 
| Buhar basıncı | 0.000415mmHg at 25°C | 
| Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; | 
    
| Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; | 
    
| MSDS | |