17351-75-6 Divinyloxy 1,4-cyclohexanedimethanol |
|
| Product Name | Divinyloxy 1,4-cyclohexanedimethanol |
| Synonyms | 1,4-Cyclohexanedimethanol divinyl ether,mixture of isomers;1,4-bis(prop-1-en-1-yloxy)cyclohexane;3,5-bis(1-methylethyl)-1H-pyrazole |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.2367 |
| InChl | InChI=1/C9H16N2/c1-6(2)8-5-9(7(3)4)11-10-8/h5-7H,1-4H3,(H,10,11) |
| CAS Registry Number | 17351-75-6 |
| Molecular Structure |  |
| Density | 0.944g/cm3 |
| Melting Point | 6℃ |
| Boiling Point | 237.3°C at 760 mmHg |
| Refractive Index | 1.496 |
| Flash Point | 91.4°C |
| Vapour Pressur | 0.0696mmHg at 25°C |
| Hazard Symbols |  Xi##Irritant||N##Dangerous for the environment:; |
| Risk Codes | R43||R51/53:; |
| Safety Description | S24||S37||S61:; |
Chemindex > 17351-75-6 Divinyloxy 1,4-cyclohexanedimethanol