17969-22-1 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole |
|
| Product Name | 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole |
| Molecular Formula | C10H7Cl2NS |
| Molecular Weight | 244.1403 |
| InChl | InChI=1/C10H7Cl2NS/c11-5-9-6-14-10(13-9)7-1-3-8(12)4-2-7/h1-4,6H,5H2 |
| CAS Registry Number | 17969-22-1 |
| Molecular Structure |  |
| Density | 1.378g/cm3 |
| Melting Point | 78℃ |
| Boiling Point | 374°C at 760 mmHg |
| Refractive Index | 1.617 |
| Flash Point | 180°C |
| Vapour Pressur | 1.85E-05mmHg at 25°C |
| Hazard Symbols |  C##Corrosive:; |
| Risk Codes | R34##Causes burns.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
Chemindex > 17969-22-1 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole