ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
27151-57-1 4,4'-Dimethoxy-N-methyldiphenylamine |
|
| Chemical Name | 4,4'-Dimethoxy-N-methyldiphenylamine |
| Synonyms | N-(4-Methoxyphenyl)-N-methyl-p-anisidine;4-methoxy-N-(4-methoxyphenyl)-N-methylaniline |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.301 |
| InChl | InChI=1/C15H17NO2/c1-16(12-4-8-14(17-2)9-5-12)13-6-10-15(18-3)11-7-13/h4-11H,1-3H3 |
| CAS Registry Number | 27151-57-1 |
| EINECS | 248-265-3 |
| Molecular Structure | ![]() |
| Density | 1.095g/cm3 |
| Boiling Point | 387.3°C at 760 mmHg |
| Refractive Index | 1.578 |
| Flash Point | 145.9°C |
| Vapour Pressur | 3.32E-06mmHg at 25°C |
| Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Safety Description | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |