ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
42601-04-7 3,4-Difluorophenyl isocyanate |
|
| Chemical Name | 3,4-Difluorophenyl isocyanate |
| Synonyms | 1,2-difluoro-4-isocyanatobenzene |
| Molecular Formula | C7H3F2NO |
| Molecular Weight | 155.1016 |
| InChl | InChI=1/C7H3F2NO/c8-6-2-1-5(10-4-11)3-7(6)9/h1-3H |
| CAS Registry Number | 42601-04-7 |
| Molecular Structure | ![]() |
| Density | 1.24g/cm3 |
| Boiling Point | 186.4°C at 760 mmHg |
| Refractive Index | 1.488 |
| Flash Point | 58.9°C |
| Vapour Pressur | 0.665mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |