ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
164670-44-4 4-Pyridylthiourea |
|
| Chemical Name | 4-Pyridylthiourea |
| Synonyms | 1-pyridin-4-ylthiourea |
| Molecular Formula | C6H7N3S |
| Molecular Weight | 153.2049 |
| InChl | InChI=1/C6H7N3S/c7-6(10)9-5-1-3-8-4-2-5/h1-4H,(H3,7,8,9,10) |
| CAS Registry Number | 164670-44-4 |
| Molecular Structure | ![]() |
| Density | 1.382g/cm3 |
| Melting Point | 181℃ |
| Boiling Point | 298.7°C at 760 mmHg |
| Refractive Index | 1.742 |
| Flash Point | 134.4°C |
| Vapour Pressur | 0.00125mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Safety Description | S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |